C13H17BrN2S2 — CID 136688133
N-[2-(5-bromothiophen-2-yl)ethyl]-3-thia-1-azaspiro[4.4]nonan-2-imine (PubChem CID 136688133) has the molecular formula C13H17BrN2S2 and a molecular weight of 345.33 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-3-thia-1-azaspiro[4.4]nonan-2-imine.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-3-thia-1-azaspiro[4.4]nonan-2-imine |
|---|---|
| PubChem CID | 136688133 |
| Molecular Formula | C13H17BrN2S2 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-3-thia-1-azaspiro[4.4]nonan-2-imine |
| SMILES | Brc1ccc(CC/N=C2/NC3(CCCC3)CS2)s1 |
| InChI | InChI=1S/C13H17BrN2S2/c14-11-4-3-10(18-11)5-8-15-12-16-13(9-17-12)6-1-2-7-13/h3-4H,1-2,5-9H2,(H,15,16) |
| InChIKey | PLVMURDBAULROC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|