C15H18Cl2N2OS — CID 136819474
N-[2-(2,4-dichlorophenyl)ethyl]-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine (PubChem CID 136819474) has the molecular formula C15H18Cl2N2OS and a molecular weight of 345.30 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine |
|---|---|
| PubChem CID | 136819474 |
| Molecular Formula | C15H18Cl2N2OS |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine |
| SMILES | Clc1ccc(CC/N=C2/NC3(CCOCC3)CS2)c(Cl)c1 |
| InChI | InChI=1S/C15H18Cl2N2OS/c16-12-2-1-11(13(17)9-12)3-6-18-14-19-15(10-21-14)4-7-20-8-5-15/h1-2,9H,3-8,10H2,(H,18,19) |
| InChIKey | RTEBHXMFRCFNPC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|