C15H18N2O3S — CID 136819669
N-(1,3-benzodioxol-5-ylmethyl)-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine (PubChem CID 136819669) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine |
|---|---|
| PubChem CID | 136819669 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-8-oxa-3-thia-1-azaspiro[4.5]decan-2-imine |
| SMILES | c1cc2c(cc1C/N=C1/NC3(CCOCC3)CS1)OCO2 |
| InChI | InChI=1S/C15H18N2O3S/c1-2-12-13(20-10-19-12)7-11(1)8-16-14-17-15(9-21-14)3-5-18-6-4-15/h1-2,7H,3-6,8-10H2,(H,16,17) |
| InChIKey | XAALPWKUIWMHKM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|