C15H13N3O2S — CID 142573841
N-(1,3-benzodioxol-5-ylmethyl)-4H-1,2,4-benzothiadiazin-3-imine (PubChem CID 142573841) has the molecular formula C15H13N3O2S and a molecular weight of 299.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4H-1,2,4-benzothiadiazin-3-imine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4H-1,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 142573841 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4H-1,2,4-benzothiadiazin-3-imine |
| SMILES | c1ccc2c(c1)N/C(=N/Cc1ccc3c(c1)OCO3)NS2 |
| InChI | InChI=1S/C15H13N3O2S/c1-2-4-14-11(3-1)17-15(18-21-14)16-8-10-5-6-12-13(7-10)20-9-19-12/h1-7H,8-9H2,(H2,16,17,18) |
| InChIKey | KCSDVQMYNHEVMM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|