C18H12ClNO4 — CID 7309637
2-(1,3-benzodioxol-5-ylmethylimino)-3-chloronaphthalene-1,4-dione (PubChem CID 7309637) has the molecular formula C18H12ClNO4 and a molecular weight of 341.75 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylimino)-3-chloronaphthalene-1,4-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylimino)-3-chloronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 7309637 |
| Molecular Formula | C18H12ClNO4 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylimino)-3-chloronaphthalene-1,4-dione |
| SMILES | O=C1/C(=N/Cc2ccc3c(c2)OCO3)C(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C18H12ClNO4/c19-15-16(18(22)12-4-2-1-3-11(12)17(15)21)20-8-10-5-6-13-14(7-10)24-9-23-13/h1-7,15H,8-9H2/b20-16+ |
| InChIKey | KNNOZZQBAKATAM-CAPFRKAQSA-N |
| XLogP | 3.04 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|