C21H11F3O5 — CID 102450132
3-(1,3-benzodioxol-5-ylmethyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione (PubChem CID 102450132) has the molecular formula C21H11F3O5 and a molecular weight of 400.31 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 102450132 |
| Molecular Formula | C21H11F3O5 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-2-(trifluoromethyl)benzo[f][1]benzofuran-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1oc(C(F)(F)F)c2Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H11F3O5/c22-21(23,24)20-13(7-10-5-6-14-15(8-10)28-9-27-14)16-17(25)11-3-1-2-4-12(11)18(26)19(16)29-20/h1-6,8H,7,9H2 |
| InChIKey | NYUVQSRGSFHSGP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|