C14H9F4NO4S — CID 90101734
4-(1,3-benzodioxol-5-ylmethyl)-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 90101734) has the molecular formula C14H9F4NO4S and a molecular weight of 363.29 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 90101734 |
| Molecular Formula | C14H9F4NO4S |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(Cc2ccc3c(c2)OCO3)c(F)c1F |
| InChI | InChI=1S/C14H9F4NO4S/c15-10-7(3-6-1-2-8-9(4-6)23-5-22-8)11(16)13(18)14(12(10)17)24(19,20)21/h1-2,4H,3,5H2,(H2,19,20,21) |
| InChIKey | BCJQGUSIDHTEHT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|