C17H12F4N2O4 — CID 166184902
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2,3,5,6-tetrafluorophenyl)methyl]oxamide (PubChem CID 166184902) has the molecular formula C17H12F4N2O4 and a molecular weight of 384.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2,3,5,6-tetrafluorophenyl)methyl]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2,3,5,6-tetrafluorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 166184902 |
| Molecular Formula | C17H12F4N2O4 |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2,3,5,6-tetrafluorophenyl)methyl]oxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(=O)NCc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C17H12F4N2O4/c18-10-4-11(19)15(21)9(14(10)20)6-23-17(25)16(24)22-5-8-1-2-12-13(3-8)27-7-26-12/h1-4H,5-7H2,(H,22,24)(H,23,25) |
| InChIKey | GHZSKIKIHARAEP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|