C18H18N2O5 — CID 108502994
N'-(1,3-benzodioxol-5-ylmethyl)-N-[2-(4-hydroxyphenyl)ethyl]oxamide (PubChem CID 108502994) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-ylmethyl)-N-[2-(4-hydroxyphenyl)ethyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-ylmethyl)-N-[2-(4-hydroxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108502994 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N'-(1,3-benzodioxol-5-ylmethyl)-N-[2-(4-hydroxyphenyl)ethyl]oxamide |
| SMILES | O=C(NCCc1ccc(O)cc1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H18N2O5/c21-14-4-1-12(2-5-14)7-8-19-17(22)18(23)20-10-13-3-6-15-16(9-13)25-11-24-15/h1-6,9,21H,7-8,10-11H2,(H,19,22)(H,20,23) |
| InChIKey | HUIDWLHELYFPBO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|