C19H17NO6 — CID 58348844
4-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylmethyl)-2-oxobutanamide (PubChem CID 58348844) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylmethyl)-2-oxobutanamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylmethyl)-2-oxobutanamide |
|---|---|
| PubChem CID | 58348844 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylmethyl)-2-oxobutanamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17NO6/c21-14(4-1-12-2-5-15-17(7-12)25-10-23-15)19(22)20-9-13-3-6-16-18(8-13)26-11-24-16/h2-3,5-8H,1,4,9-11H2,(H,20,22) |
| InChIKey | RAOIYSAMDCKPBI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|