C17H14ClFN2O4 — CID 86996452
N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-(4-chloro-2-fluorophenyl)oxamide (PubChem CID 86996452) has the molecular formula C17H14ClFN2O4 and a molecular weight of 364.76 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-(4-chloro-2-fluorophenyl)oxamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-(4-chloro-2-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 86996452 |
| Molecular Formula | C17H14ClFN2O4 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-(4-chloro-2-fluorophenyl)oxamide |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C17H14ClFN2O4/c18-11-2-3-13(12(19)8-11)21-17(23)16(22)20-6-5-10-1-4-14-15(7-10)25-9-24-14/h1-4,7-8H,5-6,9H2,(H,20,22)(H,21,23) |
| InChIKey | FNWOEIICOXUVHC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|