C21H20N2O5 — CID 119103420
N'-(1,3-benzodioxol-5-ylmethyl)-N-[3-(1-benzofuran-2-yl)propyl]oxamide (PubChem CID 119103420) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-ylmethyl)-N-[3-(1-benzofuran-2-yl)propyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-ylmethyl)-N-[3-(1-benzofuran-2-yl)propyl]oxamide |
|---|---|
| PubChem CID | 119103420 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N'-(1,3-benzodioxol-5-ylmethyl)-N-[3-(1-benzofuran-2-yl)propyl]oxamide |
| SMILES | O=C(NCCCc1cc2ccccc2o1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H20N2O5/c24-20(21(25)23-12-14-7-8-18-19(10-14)27-13-26-18)22-9-3-5-16-11-15-4-1-2-6-17(15)28-16/h1-2,4,6-8,10-11H,3,5,9,12-13H2,(H,22,24)(H,23,25) |
| InChIKey | LKBGTTOGSOZPSA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|