C20H17N3O3 — CID 119103412
N-[3-(1-benzofuran-2-yl)propyl]-N'-(2-cyanophenyl)oxamide (PubChem CID 119103412) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-[3-(1-benzofuran-2-yl)propyl]-N'-(2-cyanophenyl)oxamide.
| Compound Name | N-[3-(1-benzofuran-2-yl)propyl]-N'-(2-cyanophenyl)oxamide |
|---|---|
| PubChem CID | 119103412 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[3-(1-benzofuran-2-yl)propyl]-N'-(2-cyanophenyl)oxamide |
| SMILES | N#Cc1ccccc1NC(=O)C(=O)NCCCc1cc2ccccc2o1 |
| InChI | InChI=1S/C20H17N3O3/c21-13-15-7-1-3-9-17(15)23-20(25)19(24)22-11-5-8-16-12-14-6-2-4-10-18(14)26-16/h1-4,6-7,9-10,12H,5,8,11H2,(H,22,24)(H,23,25) |
| InChIKey | UHAPDFFQANPYCC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|