C20H26N4O3 — CID 91624117
N'-(2-cyanophenyl)-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide (PubChem CID 91624117) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N'-(2-cyanophenyl)-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-(2-cyanophenyl)-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 91624117 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N'-(2-cyanophenyl)-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide |
| SMILES | N#Cc1ccccc1NC(=O)C(=O)NCC1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C20H26N4O3/c21-13-16-3-1-2-4-18(16)23-20(26)19(25)22-14-15-5-9-24(10-6-15)17-7-11-27-12-8-17/h1-4,15,17H,5-12,14H2,(H,22,25)(H,23,26) |
| InChIKey | FUVBNXSGTCVMLF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|