C14H19N4O2+ — CID 7292746
3-[[2-(2-cyanoanilino)-2-oxoacetyl]amino]propyl-dimethylazanium (PubChem CID 7292746) has the molecular formula C14H19N4O2+ and a molecular weight of 275.33 g/mol. Its IUPAC name is 3-[[2-(2-cyanoanilino)-2-oxoacetyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[2-(2-cyanoanilino)-2-oxoacetyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7292746 |
| Molecular Formula | C14H19N4O2+ |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-[[2-(2-cyanoanilino)-2-oxoacetyl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNC(=O)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C14H18N4O2/c1-18(2)9-5-8-16-13(19)14(20)17-12-7-4-3-6-11(12)10-15/h3-4,6-7H,5,8-9H2,1-2H3,(H,16,19)(H,17,20)/p+1 |
| InChIKey | IPFLVDHPOVZSIF-UHFFFAOYSA-O |
| XLogP | -0.85 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|