C19H15N3O2S2 — CID 155801263
N'-(2-cyanophenyl)-N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]oxamide (PubChem CID 155801263) has the molecular formula C19H15N3O2S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N'-(2-cyanophenyl)-N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]oxamide.
| Compound Name | N'-(2-cyanophenyl)-N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 155801263 |
| Molecular Formula | C19H15N3O2S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N'-(2-cyanophenyl)-N-[2-(5-thiophen-2-ylthiophen-2-yl)ethyl]oxamide |
| SMILES | N#Cc1ccccc1NC(=O)C(=O)NCCc1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C19H15N3O2S2/c20-12-13-4-1-2-5-15(13)22-19(24)18(23)21-10-9-14-7-8-17(26-14)16-6-3-11-25-16/h1-8,11H,9-10H2,(H,21,23)(H,22,24) |
| InChIKey | TYDNJXIYIJRPCY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|