C17H12O4 — CID 171384168
2-(1,3-benzodioxol-5-ylmethyl)indene-1,3-dione (PubChem CID 171384168) has the molecular formula C17H12O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)indene-1,3-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)indene-1,3-dione |
|---|---|
| PubChem CID | 171384168 |
| Molecular Formula | C17H12O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H12O4/c18-16-11-3-1-2-4-12(11)17(19)13(16)7-10-5-6-14-15(8-10)21-9-20-14/h1-6,8,13H,7,9H2 |
| InChIKey | PJHDXMAPSIFVRO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|