C19H20ClNO4S — CID 46086954
4-(1,3-benzodioxol-5-ylmethyl)-1-(2-chlorophenyl)sulfonylpiperidine (PubChem CID 46086954) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-1-(2-chlorophenyl)sulfonylpiperidine.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-1-(2-chlorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 46086954 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-1-(2-chlorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCC(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H20ClNO4S/c20-16-3-1-2-4-19(16)26(22,23)21-9-7-14(8-10-21)11-15-5-6-17-18(12-15)25-13-24-17/h1-6,12,14H,7-11,13H2 |
| InChIKey | INCJBGHDIRSLEX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |