C19H15N3O3S — CID 135770880
N-(1,3-benzodioxol-5-ylmethyl)-5-(1-benzofuran-2-yl)-3,4-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135770880) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-(1-benzofuran-2-yl)-3,4-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(1-benzofuran-2-yl)-3,4-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135770880 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(1-benzofuran-2-yl)-3,4-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | C1=C(c2cc3ccccc3o2)NN/C(=N/Cc2ccc3c(c2)OCO3)S1 |
| InChI | InChI=1S/C19H15N3O3S/c1-2-4-15-13(3-1)8-17(25-15)14-10-26-19(22-21-14)20-9-12-5-6-16-18(7-12)24-11-23-16/h1-8,10,21H,9,11H2,(H,20,22) |
| InChIKey | LQEKWCJNYCLGAS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|