C16H11NO4 — CID 56708499
6-(1-benzofuran-2-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 56708499) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 6-(1-benzofuran-2-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-(1-benzofuran-2-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 56708499 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 6-(1-benzofuran-2-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | NC(=O)c1cc2c(cc1-c1cc3ccccc3o1)OCO2 |
| InChI | InChI=1S/C16H11NO4/c17-16(18)11-7-15-14(19-8-20-15)6-10(11)13-5-9-3-1-2-4-12(9)21-13/h1-7H,8H2,(H2,17,18) |
| InChIKey | NGULEQPRDIVUKC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |