C20H15NO4 — CID 71963942
1-(1-benzofuran-2-yl)-2-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidene)ethanone (PubChem CID 71963942) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidene)ethanone.
| Compound Name | 1-(1-benzofuran-2-yl)-2-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidene)ethanone |
|---|---|
| PubChem CID | 71963942 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidene)ethanone |
| SMILES | O=C(C=C1NCCc2cc3c(cc21)OCO3)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H15NO4/c22-16(18-8-13-3-1-2-4-17(13)25-18)10-15-14-9-20-19(23-11-24-20)7-12(14)5-6-21-15/h1-4,7-10,21H,5-6,11H2 |
| InChIKey | BYIYRKYFVUWEHX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|