C17H14N2O3 — CID 71963957
2-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidene)-1-pyridin-2-ylethanone (PubChem CID 71963957) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidene)-1-pyridin-2-ylethanone.
| Compound Name | 2-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidene)-1-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 71963957 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-(7,8-dihydro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-ylidene)-1-pyridin-2-ylethanone |
| SMILES | O=C(C=C1NCCc2cc3c(cc21)OCO3)c1ccccn1 |
| InChI | InChI=1S/C17H14N2O3/c20-15(13-3-1-2-5-18-13)9-14-12-8-17-16(21-10-22-17)7-11(12)4-6-19-14/h1-3,5,7-9,19H,4,6,10H2 |
| InChIKey | ONGPLFBEUZCMKN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|