C18H13NO2 — CID 15507696
5,7-dioxa-15-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 15507696) has the molecular formula C18H13NO2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 5,7-dioxa-15-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 5,7-dioxa-15-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 15507696 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 5,7-dioxa-15-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | c1ccc2c3c(cnc2c1)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C18H13NO2/c1-2-4-15-13(3-1)18-12(9-19-15)6-5-11-7-16-17(8-14(11)18)21-10-20-16/h1-4,7-9H,5-6,10H2 |
| InChIKey | GACGRRXJWSWUNI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |