C14H8ClNO2 — CID 11032549
6-chloro-[1,3]dioxolo[4,5-j]phenanthridine (PubChem CID 11032549) has the molecular formula C14H8ClNO2 and a molecular weight of 257.68 g/mol. Its IUPAC name is 6-chloro-[1,3]dioxolo[4,5-j]phenanthridine.
| Compound Name | 6-chloro-[1,3]dioxolo[4,5-j]phenanthridine |
|---|---|
| PubChem CID | 11032549 |
| Molecular Formula | C14H8ClNO2 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 6-chloro-[1,3]dioxolo[4,5-j]phenanthridine |
| SMILES | Clc1nc2ccccc2c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C14H8ClNO2/c15-14-10-6-13-12(17-7-18-13)5-9(10)8-3-1-2-4-11(8)16-14/h1-6H,7H2 |
| InChIKey | QSZDPKFVIWPPNM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|