C10H6ClNO2 — CID 21192459
5-chloro-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 21192459) has the molecular formula C10H6ClNO2 and a molecular weight of 207.62 g/mol. Its IUPAC name is 5-chloro-[1,3]dioxolo[4,5-g]isoquinoline.
| Compound Name | 5-chloro-[1,3]dioxolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 21192459 |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.62 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 5-chloro-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | Clc1nccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C10H6ClNO2/c11-10-7-4-9-8(13-5-14-9)3-6(7)1-2-12-10/h1-4H,5H2 |
| InChIKey | LECAAVNQZQPFEY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|