About 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine
1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine (PubChem CID 106541712) has the molecular formula C13H10N4O2
and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine.
Molecular Properties
| Compound Name | 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine |
| PubChem CID | 106541712 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine |
| SMILES | Nc1ccn(-c2nccc3cc4c(cc23)OCO4)n1 |
| InChI | InChI=1S/C13H10N4O2/c14-12-2-4-17(16-12)13-9-6-11-10(18-7-19-11)5-8(9)1-3-15-13/h1-6H,7H2,(H2,14,16) |
| InChIKey | HIFRXZUUJKGJNT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine?
The IUPAC name of 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine (CID 106541712) is 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine.
What is the SMILES notation for 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine?
The canonical SMILES for 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine is Nc1ccn(-c2nccc3cc4c(cc23)OCO4)n1.
What is the InChIKey of 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine?
The InChIKey is HIFRXZUUJKGJNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O2/c14-12-2-4-17(16-12)13-9-6-11-10(18-7-19-11)5-8(9)1-3-15-13/h1-6H,7H2,(H2,14,16).
What are the key properties of 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine?
1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine has a molecular weight of 254.25 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)pyrazol-3-amine is sourced from PubChem (CID 106541712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).