About 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline
5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 106542351) has the molecular formula C15H17N3O2
and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline.
Molecular Properties
| Compound Name | 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline |
| PubChem CID | 106542351 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | CC1CNCCN1c1nccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C15H17N3O2/c1-10-8-16-4-5-18(10)15-12-7-14-13(19-9-20-14)6-11(12)2-3-17-15/h2-3,6-7,10,16H,4-5,8-9H2,1H3 |
| InChIKey | XVEMWGMTFJTIMK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline?
The IUPAC name of 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline (CID 106542351) is 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline.
What is the SMILES notation for 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline?
The canonical SMILES for 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline is CC1CNCCN1c1nccc2cc3c(cc12)OCO3.
What is the InChIKey of 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline?
The InChIKey is XVEMWGMTFJTIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-10-8-16-4-5-18(10)15-12-7-14-13(19-9-20-14)6-11(12)2-3-17-15/h2-3,6-7,10,16H,4-5,8-9H2,1H3.
What are the key properties of 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline?
5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline has a molecular weight of 271.32 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline is sourced from PubChem (CID 106542351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).