C15H17N3O2 — CID 106542351
5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 106542351) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline.
| Compound Name | 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 106542351 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 5-(2-methylpiperazin-1-yl)-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | CC1CNCCN1c1nccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C15H17N3O2/c1-10-8-16-4-5-18(10)15-12-7-14-13(19-9-20-14)6-11(12)2-3-17-15/h2-3,6-7,10,16H,4-5,8-9H2,1H3 |
| InChIKey | XVEMWGMTFJTIMK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |