C8H13N3O — CID 151453057
2-[(2S)-2-methylpiperazin-1-yl]-1,3-oxazole (PubChem CID 151453057) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-[(2S)-2-methylpiperazin-1-yl]-1,3-oxazole.
| Compound Name | 2-[(2S)-2-methylpiperazin-1-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 151453057 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-[(2S)-2-methylpiperazin-1-yl]-1,3-oxazole |
| SMILES | C[C@H]1CNCCN1c1ncco1 |
| InChI | InChI=1S/C8H13N3O/c1-7-6-9-2-4-11(7)8-10-3-5-12-8/h3,5,7,9H,2,4,6H2,1H3/t7-/m0/s1 |
| InChIKey | PGWSQLKGNKNYKX-ZETCQYMHSA-N |
| XLogP | 0.47 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |