C15H16N2O3 — CID 106542072
5-(pyrrolidin-3-ylmethoxy)-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 106542072) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 5-(pyrrolidin-3-ylmethoxy)-[1,3]dioxolo[4,5-g]isoquinoline.
| Compound Name | 5-(pyrrolidin-3-ylmethoxy)-[1,3]dioxolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 106542072 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 5-(pyrrolidin-3-ylmethoxy)-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | c1cc2cc3c(cc2c(OCC2CCNC2)n1)OCO3 |
| InChI | InChI=1S/C15H16N2O3/c1-3-16-7-10(1)8-18-15-12-6-14-13(19-9-20-14)5-11(12)2-4-17-15/h2,4-6,10,16H,1,3,7-9H2 |
| InChIKey | ZDQWBGYSFJQJKW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |