C13H13NO2 — CID 16638151
5-propyl-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 16638151) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 5-propyl-[1,3]dioxolo[4,5-g]isoquinoline.
| Compound Name | 5-propyl-[1,3]dioxolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 16638151 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 5-propyl-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | CCCc1nccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C13H13NO2/c1-2-3-11-10-7-13-12(15-8-16-13)6-9(10)4-5-14-11/h4-7H,2-3,8H2,1H3 |
| InChIKey | HBZWIFDSECLXEV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |