C16H20N2O3 — CID 106541427
2-[butyl([1,3]dioxolo[4,5-g]isoquinolin-5-yl)amino]ethanol (PubChem CID 106541427) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[butyl([1,3]dioxolo[4,5-g]isoquinolin-5-yl)amino]ethanol.
| Compound Name | 2-[butyl([1,3]dioxolo[4,5-g]isoquinolin-5-yl)amino]ethanol |
|---|---|
| PubChem CID | 106541427 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[butyl([1,3]dioxolo[4,5-g]isoquinolin-5-yl)amino]ethanol |
| SMILES | CCCCN(CCO)c1nccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C16H20N2O3/c1-2-3-6-18(7-8-19)16-13-10-15-14(20-11-21-15)9-12(13)4-5-17-16/h4-5,9-10,19H,2-3,6-8,11H2,1H3 |
| InChIKey | DKMKNPZULLQKQJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |