C21H24NO8P — CID 24837672
5-[(3-methoxy-4-propoxyphenyl)methyl]-[1,3]dioxolo[4,5-g]isoquinoline;phosphoric acid (PubChem CID 24837672) has the molecular formula C21H24NO8P and a molecular weight of 449.40 g/mol. Its IUPAC name is 5-[(3-methoxy-4-propoxyphenyl)methyl]-[1,3]dioxolo[4,5-g]isoquinoline;phosphoric acid.
| Compound Name | 5-[(3-methoxy-4-propoxyphenyl)methyl]-[1,3]dioxolo[4,5-g]isoquinoline;phosphoric acid |
|---|---|
| PubChem CID | 24837672 |
| Molecular Formula | C21H24NO8P |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 5-[(3-methoxy-4-propoxyphenyl)methyl]-[1,3]dioxolo[4,5-g]isoquinoline;phosphoric acid |
| SMILES | CCCOc1ccc(Cc2nccc3cc4c(cc23)OCO4)cc1OC.O=P(O)(O)O |
| InChI | InChI=1S/C21H21NO4.H3O4P/c1-3-8-24-18-5-4-14(10-19(18)23-2)9-17-16-12-21-20(25-13-26-21)11-15(16)6-7-22-17;1-5(2,3)4/h4-7,10-12H,3,8-9,13H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | UBBVXURNGIMLFP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|