C20H19NO4 — CID 135290952
4-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-2-methoxybenzaldehyde (PubChem CID 135290952) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-2-methoxybenzaldehyde.
| Compound Name | 4-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 135290952 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-2-methoxybenzaldehyde |
| SMILES | COc1cc(Cc2nccc3cc(OC)c(OC)cc23)ccc1C=O |
| InChI | InChI=1S/C20H19NO4/c1-23-18-9-13(4-5-15(18)12-22)8-17-16-11-20(25-3)19(24-2)10-14(16)6-7-21-17/h4-7,9-12H,8H2,1-3H3 |
| InChIKey | VPCKDKDJGXHFOA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|