C13H15NO3 — CID 116995192
2-(6,7-dimethoxyisoquinolin-1-yl)ethanol (PubChem CID 116995192) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(6,7-dimethoxyisoquinolin-1-yl)ethanol.
| Compound Name | 2-(6,7-dimethoxyisoquinolin-1-yl)ethanol |
|---|---|
| PubChem CID | 116995192 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-(6,7-dimethoxyisoquinolin-1-yl)ethanol |
| SMILES | COc1cc2ccnc(CCO)c2cc1OC |
| InChI | InChI=1S/C13H15NO3/c1-16-12-7-9-3-5-14-11(4-6-15)10(9)8-13(12)17-2/h3,5,7-8,15H,4,6H2,1-2H3 |
| InChIKey | OQZXLFSDTAOSRL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |