C25H33Cl2NO2S — CID 23192844
6,7-dimethoxy-1-[7-(4-methylphenyl)sulfanylheptyl]isoquinoline;dihydrochloride (PubChem CID 23192844) has the molecular formula C25H33Cl2NO2S and a molecular weight of 482.52 g/mol. Its IUPAC name is 6,7-dimethoxy-1-[7-(4-methylphenyl)sulfanylheptyl]isoquinoline;dihydrochloride.
| Compound Name | 6,7-dimethoxy-1-[7-(4-methylphenyl)sulfanylheptyl]isoquinoline;dihydrochloride |
|---|---|
| PubChem CID | 23192844 |
| Molecular Formula | C25H33Cl2NO2S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 6,7-dimethoxy-1-[7-(4-methylphenyl)sulfanylheptyl]isoquinoline;dihydrochloride |
| SMILES | COc1cc2ccnc(CCCCCCCSc3ccc(C)cc3)c2cc1OC.Cl.Cl |
| InChI | InChI=1S/C25H31NO2S.2ClH/c1-19-10-12-21(13-11-19)29-16-8-6-4-5-7-9-23-22-18-25(28-3)24(27-2)17-20(22)14-15-26-23;;/h10-15,17-18H,4-9,16H2,1-3H3;2*1H |
| InChIKey | KXKCNSPJXJAUAN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|