C20H21NO2 — CID 153397750
1-[(3,4-dimethylphenyl)methyl]-6,7-dimethoxyisoquinoline (PubChem CID 153397750) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-[(3,4-dimethylphenyl)methyl]-6,7-dimethoxyisoquinoline.
| Compound Name | 1-[(3,4-dimethylphenyl)methyl]-6,7-dimethoxyisoquinoline |
|---|---|
| PubChem CID | 153397750 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-[(3,4-dimethylphenyl)methyl]-6,7-dimethoxyisoquinoline |
| SMILES | COc1cc2ccnc(Cc3ccc(C)c(C)c3)c2cc1OC |
| InChI | InChI=1S/C20H21NO2/c1-13-5-6-15(9-14(13)2)10-18-17-12-20(23-4)19(22-3)11-16(17)7-8-21-18/h5-9,11-12H,10H2,1-4H3 |
| InChIKey | IIWAZLJRPRFVFS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |