C21H23NO3 — CID 150556575
6,7-dimethoxy-1-[(3-propan-2-yloxyphenyl)methyl]isoquinoline (PubChem CID 150556575) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 6,7-dimethoxy-1-[(3-propan-2-yloxyphenyl)methyl]isoquinoline.
| Compound Name | 6,7-dimethoxy-1-[(3-propan-2-yloxyphenyl)methyl]isoquinoline |
|---|---|
| PubChem CID | 150556575 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 6,7-dimethoxy-1-[(3-propan-2-yloxyphenyl)methyl]isoquinoline |
| SMILES | COc1cc2ccnc(Cc3cccc(OC(C)C)c3)c2cc1OC |
| InChI | InChI=1S/C21H23NO3/c1-14(2)25-17-7-5-6-15(10-17)11-19-18-13-21(24-4)20(23-3)12-16(18)8-9-22-19/h5-10,12-14H,11H2,1-4H3 |
| InChIKey | IIYRKTCOOWUZSF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |