C32H35NO13 — CID 71315397
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[1-[(3,4-dimethoxyphenyl)methyl]-7-methoxyisoquinolin-6-yl]oxyoxane-2-carboxylate (PubChem CID 71315397) has the molecular formula C32H35NO13 and a molecular weight of 641.63 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[1-[(3,4-dimethoxyphenyl)methyl]-7-methoxyisoquinolin-6-yl]oxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[1-[(3,4-dimethoxyphenyl)methyl]-7-methoxyisoquinolin-6-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 71315397 |
| Molecular Formula | C32H35NO13 |
| Molecular Weight | 641.63 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[1-[(3,4-dimethoxyphenyl)methyl]-7-methoxyisoquinolin-6-yl]oxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2cc3ccnc(Cc4ccc(OC)c(OC)c4)c3cc2OC)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H35NO13/c1-16(34)42-27-28(43-17(2)35)30(44-18(3)36)32(46-29(27)31(37)41-7)45-26-14-20-10-11-33-22(21(20)15-25(26)40-6)12-19-8-9-23(38-4)24(13-19)39-5/h8-11,13-15,27-30,32H,12H2,1-7H3/t27-,28-,29-,30+,32+/m0/s1 |
| InChIKey | ZWGPYACNADIBPB-SIKAAIQYSA-N |
| XLogP | 2.92 |
| TPSA | 164.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.63 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|