C20H21NO5 — CID 174897371
1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-8-ol (PubChem CID 174897371) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-8-ol.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-8-ol |
|---|---|
| PubChem CID | 174897371 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-8-ol |
| SMILES | COc1ccc(Cc2nccc3cc(OC)c(OC)c(O)c23)cc1OC |
| InChI | InChI=1S/C20H21NO5/c1-23-15-6-5-12(10-16(15)24-2)9-14-18-13(7-8-21-14)11-17(25-3)20(26-4)19(18)22/h5-8,10-11,22H,9H2,1-4H3 |
| InChIKey | SDXJSBFZRLDWAX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |