About [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol
[3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol (PubChem CID 54192940) has the molecular formula C15H17NO3
and a molecular weight of 259.31 g/mol. Its IUPAC name is [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol |
| PubChem CID | 54192940 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol |
| SMILES | COc1ccc(Cc2cccnc2CO)cc1OC |
| InChI | InChI=1S/C15H17NO3/c1-18-14-6-5-11(9-15(14)19-2)8-12-4-3-7-16-13(12)10-17/h3-7,9,17H,8,10H2,1-2H3 |
| InChIKey | PJTTVYVKHPVXHG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol?
The IUPAC name of [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol (CID 54192940) is [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol.
What is the SMILES notation for [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol?
The canonical SMILES for [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol is COc1ccc(Cc2cccnc2CO)cc1OC.
What is the InChIKey of [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol?
The InChIKey is PJTTVYVKHPVXHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3/c1-18-14-6-5-11(9-15(14)19-2)8-12-4-3-7-16-13(12)10-17/h3-7,9,17H,8,10H2,1-2H3.
What are the key properties of [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol?
[3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol has a molecular weight of 259.31 g/mol, XLogP of 2.18, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanol is sourced from PubChem (CID 54192940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).