C14H15NO3 — CID 54102100
[2-(3,4-dimethoxyphenyl)-3-pyridinyl]methanol (PubChem CID 54102100) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-3-pyridinyl]methanol.
| Compound Name | [2-(3,4-dimethoxyphenyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 54102100 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-3-pyridinyl]methanol |
| SMILES | COc1ccc(-c2ncccc2CO)cc1OC |
| InChI | InChI=1S/C14H15NO3/c1-17-12-6-5-10(8-13(12)18-2)14-11(9-16)4-3-7-15-14/h3-8,16H,9H2,1-2H3 |
| InChIKey | NBEYFDNCYZVJJN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |