C29H28N2O5 — CID 54160091
bis[3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanone (PubChem CID 54160091) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is bis[3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanone.
| Compound Name | bis[3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 54160091 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | bis[3-[(3,4-dimethoxyphenyl)methyl]-2-pyridinyl]methanone |
| SMILES | COc1ccc(Cc2cccnc2C(=O)c2ncccc2Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C29H28N2O5/c1-33-23-11-9-19(17-25(23)35-3)15-21-7-5-13-30-27(21)29(32)28-22(8-6-14-31-28)16-20-10-12-24(34-2)26(18-20)36-4/h5-14,17-18H,15-16H2,1-4H3 |
| InChIKey | ONUKUJRHUBSTRO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |