C16H17NO3 — CID 82185238
3-(3,4-dimethoxyphenyl)-1-pyridin-2-ylpropan-1-one (PubChem CID 82185238) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-pyridin-2-ylpropan-1-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-pyridin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 82185238 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-pyridin-2-ylpropan-1-one |
| SMILES | COc1ccc(CCC(=O)c2ccccn2)cc1OC |
| InChI | InChI=1S/C16H17NO3/c1-19-15-9-7-12(11-16(15)20-2)6-8-14(18)13-5-3-4-10-17-13/h3-5,7,9-11H,6,8H2,1-2H3 |
| InChIKey | GFJASLKPTLWCNM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |