C23H22N2O4 — CID 86186012
3-(2,5-dimethoxyphenyl)-1,5-dipyridin-2-ylpentane-1,5-dione (PubChem CID 86186012) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-1,5-dipyridin-2-ylpentane-1,5-dione.
| Compound Name | 3-(2,5-dimethoxyphenyl)-1,5-dipyridin-2-ylpentane-1,5-dione |
|---|---|
| PubChem CID | 86186012 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-1,5-dipyridin-2-ylpentane-1,5-dione |
| SMILES | COc1ccc(OC)c(C(CC(=O)c2ccccn2)CC(=O)c2ccccn2)c1 |
| InChI | InChI=1S/C23H22N2O4/c1-28-17-9-10-23(29-2)18(15-17)16(13-21(26)19-7-3-5-11-24-19)14-22(27)20-8-4-6-12-25-20/h3-12,15-16H,13-14H2,1-2H3 |
| InChIKey | PLJNTQDTCWSAKM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |