C18H22N2O3 — CID 110410541
4-(3,4-dimethoxyphenyl)-N-(pyridin-2-ylmethyl)butanamide (PubChem CID 110410541) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-(pyridin-2-ylmethyl)butanamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-(pyridin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 110410541 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-(pyridin-2-ylmethyl)butanamide |
| SMILES | COc1ccc(CCCC(=O)NCc2ccccn2)cc1OC |
| InChI | InChI=1S/C18H22N2O3/c1-22-16-10-9-14(12-17(16)23-2)6-5-8-18(21)20-13-15-7-3-4-11-19-15/h3-4,7,9-12H,5-6,8,13H2,1-2H3,(H,20,21) |
| InChIKey | PAQKHUWAFAEIMT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |