C19H27IN4O2 — CID 110968525
1-[3-(3,4-dimethoxyphenyl)propyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110968525) has the molecular formula C19H27IN4O2 and a molecular weight of 470.36 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)propyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)propyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110968525 |
| Molecular Formula | C19H27IN4O2 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)propyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1ccc(OC)c(OC)c1)NCc1ccccn1.I |
| InChI | InChI=1S/C19H26N4O2.HI/c1-20-19(23-14-16-8-4-5-11-21-16)22-12-6-7-15-9-10-17(24-2)18(13-15)25-3;/h4-5,8-11,13H,6-7,12,14H2,1-3H3,(H2,20,22,23);1H |
| InChIKey | JQDCSRLCHREGHI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|