C12H11NO2S — CID 116995483
2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-ylmethanethiol (PubChem CID 116995483) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-ylmethanethiol.
| Compound Name | 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-ylmethanethiol |
|---|---|
| PubChem CID | 116995483 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-ylmethanethiol |
| SMILES | SCc1nccc2cc3c(cc12)OCCO3 |
| InChI | InChI=1S/C12H11NO2S/c16-7-10-9-6-12-11(14-3-4-15-12)5-8(9)1-2-13-10/h1-2,5-6,16H,3-4,7H2 |
| InChIKey | GCJORRCPOVFKNK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 31.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|