C15H16ClNO2S — CID 106540276
6-(3-chloro-2-methylpropyl)sulfanyl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline (PubChem CID 106540276) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is 6-(3-chloro-2-methylpropyl)sulfanyl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline.
| Compound Name | 6-(3-chloro-2-methylpropyl)sulfanyl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 106540276 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 6-(3-chloro-2-methylpropyl)sulfanyl-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinoline |
| SMILES | CC(CCl)CSc1nccc2cc3c(cc12)OCCO3 |
| InChI | InChI=1S/C15H16ClNO2S/c1-10(8-16)9-20-15-12-7-14-13(18-4-5-19-14)6-11(12)2-3-17-15/h2-3,6-7,10H,4-5,8-9H2,1H3 |
| InChIKey | OBFOTDUCPSJIHP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|