2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid

C14H13NO4S — CID 106536865

IUPAC2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid
SMILESCCC(Sc1nccc2cc3c(cc12)OCO3)C(=O)O
InChIInChI=1S/C14H13NO4S/c1-2-12(14(16)17)20-13-9-6-11-10(18-7-19-11)5-8(9)3-4-15-13/h3-6,12H,2,7H2,1H3,(H,16,17)
InChIKeyHOMQVEWLFUHPOM-UHFFFAOYSA-N
MW291.33 g/mol
LogP2.92
Rot. Bonds4

About 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid

2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid (PubChem CID 106536865) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid.

Molecular Properties

Compound Name2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid
PubChem CID106536865
Molecular FormulaC14H13NO4S
Molecular Weight291.33 g/mol
Exact Mass291.06
IUPAC Name2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid
SMILESCCC(Sc1nccc2cc3c(cc12)OCO3)C(=O)O
InChIInChI=1S/C14H13NO4S/c1-2-12(14(16)17)20-13-9-6-11-10(18-7-19-11)5-8(9)3-4-15-13/h3-6,12H,2,7H2,1H3,(H,16,17)
InChIKeyHOMQVEWLFUHPOM-UHFFFAOYSA-N
XLogP2.92
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.33
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid?
The IUPAC name of 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid (CID 106536865) is 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid.
What is the SMILES notation for 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid?
The canonical SMILES for 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid is CCC(Sc1nccc2cc3c(cc12)OCO3)C(=O)O.
What is the InChIKey of 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid?
The InChIKey is HOMQVEWLFUHPOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4S/c1-2-12(14(16)17)20-13-9-6-11-10(18-7-19-11)5-8(9)3-4-15-13/h3-6,12H,2,7H2,1H3,(H,16,17).
What are the key properties of 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid?
2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid has a molecular weight of 291.33 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,3]dioxolo[4,5-g]isoquinolin-5-ylsulfanyl)butanoic acid is sourced from PubChem (CID 106536865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).