C21H17NO7S — CID 21408924
2-[[4,5-bis(1,3-benzodioxol-5-yl)-1,3-oxazol-2-yl]sulfanyl]butanoic acid (PubChem CID 21408924) has the molecular formula C21H17NO7S and a molecular weight of 427.43 g/mol. Its IUPAC name is 2-[[4,5-bis(1,3-benzodioxol-5-yl)-1,3-oxazol-2-yl]sulfanyl]butanoic acid.
| Compound Name | 2-[[4,5-bis(1,3-benzodioxol-5-yl)-1,3-oxazol-2-yl]sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 21408924 |
| Molecular Formula | C21H17NO7S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 2-[[4,5-bis(1,3-benzodioxol-5-yl)-1,3-oxazol-2-yl]sulfanyl]butanoic acid |
| SMILES | CCC(Sc1nc(-c2ccc3c(c2)OCO3)c(-c2ccc3c(c2)OCO3)o1)C(=O)O |
| InChI | InChI=1S/C21H17NO7S/c1-2-17(20(23)24)30-21-22-18(11-3-5-13-15(7-11)27-9-25-13)19(29-21)12-4-6-14-16(8-12)28-10-26-14/h3-8,17H,2,9-10H2,1H3,(H,23,24) |
| InChIKey | NEAHZEPGHQAKLE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |